C11H12F3IN2O — CID 171392327
4-[4-iodo-6-(trifluoromethyl)-2-pyridinyl]-2-methylmorpholine (PubChem CID 171392327) has the molecular formula C11H12F3IN2O and a molecular weight of 372.13 g/mol. Its IUPAC name is 4-[4-iodo-6-(trifluoromethyl)-2-pyridinyl]-2-methylmorpholine.
| Compound Name | 4-[4-iodo-6-(trifluoromethyl)-2-pyridinyl]-2-methylmorpholine |
|---|---|
| PubChem CID | 171392327 |
| Molecular Formula | C11H12F3IN2O |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 4-[4-iodo-6-(trifluoromethyl)-2-pyridinyl]-2-methylmorpholine |
| SMILES | CC1CN(c2cc(I)cc(C(F)(F)F)n2)CCO1 |
| InChI | InChI=1S/C11H12F3IN2O/c1-7-6-17(2-3-18-7)10-5-8(15)4-9(16-10)11(12,13)14/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | IOWAEKQMSBDJQG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|