C13H15N3O — CID 171393738
2-(methylamino)-2,2-dipyridin-2-ylethanol (PubChem CID 171393738) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(methylamino)-2,2-dipyridin-2-ylethanol.
| Compound Name | 2-(methylamino)-2,2-dipyridin-2-ylethanol |
|---|---|
| PubChem CID | 171393738 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(methylamino)-2,2-dipyridin-2-ylethanol |
| SMILES | CNC(CO)(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C13H15N3O/c1-14-13(10-17,11-6-2-4-8-15-11)12-7-3-5-9-16-12/h2-9,14,17H,10H2,1H3 |
| InChIKey | QDTOIZDQSFHYTR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |