C17H19F4N3O — CID 68312564
(3R)-3-[[3-fluoro-6-[6-(trifluoromethyl)pyridin-3-yl]pyridin-2-yl]methylamino]pentan-2-ol (PubChem CID 68312564) has the molecular formula C17H19F4N3O and a molecular weight of 357.35 g/mol. Its IUPAC name is (3R)-3-[[3-fluoro-6-[6-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]methylamino]pentan-2-ol.
| Compound Name | (3R)-3-[[3-fluoro-6-[6-(trifluoromethyl)pyridin-3-yl]pyridin-2-yl]methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 68312564 |
| Molecular Formula | C17H19F4N3O |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (3R)-3-[[3-fluoro-6-[6-(trifluoromethyl)-3-pyridinyl]-2-pyridinyl]methylamino]pentan-2-ol |
| SMILES | CC[C@H](C(C)O)NCC1=C(C=CC(=N1)C2=CN=C(C=C2)C(F)(F)F)F |
| InChI | InChI=1S/C17H19F4N3O/c1-3-13(10(2)25)22-9-15-12(18)5-6-14(24-15)11-4-7-16(23-8-11)17(19,20)21/h4-8,10,13,22,25H,3,9H2,1-2H3/t10?,13-/m1/s1 |
| InChIKey | OLJXCSWLXLONEA-JLOHTSLTSA-N |
| XLogP | 2.60 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | 410 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |