C12H24ClNO6 — CID 171394490
6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid;hydrochloride (PubChem CID 171394490) has the molecular formula C12H24ClNO6 and a molecular weight of 313.78 g/mol. Its IUPAC name is 6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid;hydrochloride.
| Compound Name | 6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 171394490 |
| Molecular Formula | C12H24ClNO6 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCCN1C[C@@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H23NO6.ClH/c14-7-8-11(18)12(19)9(15)6-13(8)5-3-1-2-4-10(16)17;/h8-9,11-12,14-15,18-19H,1-7H2,(H,16,17);1H/t8-,9-,11-,12-;/m1./s1 |
| InChIKey | SNTKUWCUWXPJLB-WFEFASIESA-N |
| XLogP | -1.19 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|