C8H9N4O+ — CID 171396495
6-methyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide (PubChem CID 171396495) has the molecular formula C8H9N4O+ and a molecular weight of 177.19 g/mol. Its IUPAC name is 6-methyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide.
| Compound Name | 6-methyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide |
|---|---|
| PubChem CID | 171396495 |
| Molecular Formula | C8H9N4O+ |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 6-methyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide |
| SMILES | Cc1cnc2c(C(N)=O)c[nH][n+]2c1 |
| InChI | InChI=1S/C8H8N4O/c1-5-2-10-8-6(7(9)13)3-11-12(8)4-5/h2-4H,1H3,(H2,9,13)/p+1 |
| InChIKey | ZSJDYGZWDYMLDS-UHFFFAOYSA-O |
| XLogP | -0.44 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|