C12H14ClNO2 — CID 171396988
2-chloro-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carboxylic acid (PubChem CID 171396988) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-chloro-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carboxylic acid.
| Compound Name | 2-chloro-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 171396988 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-chloro-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carboxylic acid |
| SMILES | CC1(C)CCc2nc(Cl)c(C(=O)O)cc2C1 |
| InChI | InChI=1S/C12H14ClNO2/c1-12(2)4-3-9-7(6-12)5-8(11(15)16)10(13)14-9/h5H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | WWYLYVCLFQOALV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|