C18H17Cl3N2O3S — CID 17139885
3-(2-ethoxyethoxy)-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide (PubChem CID 17139885) has the molecular formula C18H17Cl3N2O3S and a molecular weight of 447.77 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide.
| Compound Name | 3-(2-ethoxyethoxy)-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17139885 |
| Molecular Formula | C18H17Cl3N2O3S |
| Molecular Weight | 447.77 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 3-(2-ethoxyethoxy)-N-[(2,4,5-trichlorophenyl)carbamothioyl]benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H17Cl3N2O3S/c1-2-25-6-7-26-12-5-3-4-11(8-12)17(24)23-18(27)22-16-10-14(20)13(19)9-15(16)21/h3-5,8-10H,2,6-7H2,1H3,(H2,22,23,24,27) |
| InChIKey | IWRUDJHOLNBEPC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.77 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|