C14H17F3N2O5 — CID 171399982
(1S,2R,3R,4R,5S)-1-(methoxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 171399982) has the molecular formula C14H17F3N2O5 and a molecular weight of 350.29 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1-(methoxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-1-(methoxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 171399982 |
| Molecular Formula | C14H17F3N2O5 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1-(methoxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | COC[C@@]12CO[C@@H](O1)[C@H](Nc1cccc(C(F)(F)F)n1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C14H17F3N2O5/c1-22-5-13-6-23-12(24-13)9(10(20)11(13)21)19-8-4-2-3-7(18-8)14(15,16)17/h2-4,9-12,20-21H,5-6H2,1H3,(H,18,19)/t9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | OAHPTRAPMIPCJY-KVSVUVNWSA-N |
| XLogP | 0.37 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |