C20H23BrN2O4 — CID 17140458
N'-[2-(4-bromo-2-methylphenoxy)acetyl]-3-(2-methylpropoxy)benzohydrazide (PubChem CID 17140458) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-methylphenoxy)acetyl]-3-(2-methylpropoxy)benzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-methylphenoxy)acetyl]-3-(2-methylpropoxy)benzohydrazide |
|---|---|
| PubChem CID | 17140458 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N'-[2-(4-bromo-2-methylphenoxy)acetyl]-3-(2-methylpropoxy)benzohydrazide |
| SMILES | Cc1cc(Br)ccc1OCC(=O)NNC(=O)c1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-13(2)11-26-17-6-4-5-15(10-17)20(25)23-22-19(24)12-27-18-8-7-16(21)9-14(18)3/h4-10,13H,11-12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | KUGGBAXDHCEPMF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|