C27H20FN3O6 — CID 171407912
(19S)-19-ethyl-6-fluoro-19-hydroxy-7-methyl-10-(4-nitrophenyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 171407912) has the molecular formula C27H20FN3O6 and a molecular weight of 501.47 g/mol. Its IUPAC name is (19S)-19-ethyl-6-fluoro-19-hydroxy-7-methyl-10-(4-nitrophenyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-6-fluoro-19-hydroxy-7-methyl-10-(4-nitrophenyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 171407912 |
| Molecular Formula | C27H20FN3O6 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (19S)-19-ethyl-6-fluoro-19-hydroxy-7-methyl-10-(4-nitrophenyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)cc1c2-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H20FN3O6/c1-3-27(34)19-9-22-24-17(11-30(22)25(32)18(19)12-37-26(27)33)23(14-4-6-15(7-5-14)31(35)36)16-8-13(2)20(28)10-21(16)29-24/h4-10,34H,3,11-12H2,1-2H3/t27-/m0/s1 |
| InChIKey | IJHSAKKCLCZHJJ-MHZLTWQESA-N |
| XLogP | 4.10 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|