C28H22FN5O8 — CID 166138748
(4-nitrophenyl) N-[[(19S)-7-amino-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]methyl]carbamate (PubChem CID 166138748) has the molecular formula C28H22FN5O8 and a molecular weight of 575.51 g/mol. Its IUPAC name is (4-nitrophenyl) N-[[(19S)-7-amino-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]methyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[[(19S)-7-amino-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]methyl]carbamate |
|---|---|
| PubChem CID | 166138748 |
| Molecular Formula | C28H22FN5O8 |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | (4-nitrophenyl) N-[[(19S)-7-amino-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]methyl]carbamate |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(N)cc1c2CNC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H22FN5O8/c1-2-28(38)19-8-23-24-17(11-33(23)25(35)18(19)12-41-26(28)36)16(15-7-21(30)20(29)9-22(15)32-24)10-31-27(37)42-14-5-3-13(4-6-14)34(39)40/h3-9,38H,2,10-12,30H2,1H3,(H,31,37)/t28-/m0/s1 |
| InChIKey | OOUAAHXLBAABGH-NDEPHWFRSA-N |
| XLogP | 3.00 |
| TPSA | 188.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|