C22H25N3O4S — CID 17140805
3-(2-methylpropoxy)-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 17140805) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 3-(2-methylpropoxy)-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17140805 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-(2-methylpropoxy)-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | C=CCOc1ccccc1C(=O)NNC(=S)NC(=O)c1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C22H25N3O4S/c1-4-12-28-19-11-6-5-10-18(19)21(27)24-25-22(30)23-20(26)16-8-7-9-17(13-16)29-14-15(2)3/h4-11,13,15H,1,12,14H2,2-3H3,(H,24,27)(H2,23,25,26,30) |
| InChIKey | PVQTWULAGAIEFL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|