C20H20BrN3O4S — CID 17074194
3-bromo-4-ethoxy-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 17074194) has the molecular formula C20H20BrN3O4S and a molecular weight of 478.37 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17074194 |
| Molecular Formula | C20H20BrN3O4S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[[(2-prop-2-enoxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | C=CCOc1ccccc1C(=O)NNC(=S)NC(=O)c1ccc(OCC)c(Br)c1 |
| InChI | InChI=1S/C20H20BrN3O4S/c1-3-11-28-16-8-6-5-7-14(16)19(26)23-24-20(29)22-18(25)13-9-10-17(27-4-2)15(21)12-13/h3,5-10,12H,1,4,11H2,2H3,(H,23,26)(H2,22,24,25,29) |
| InChIKey | TUNJGPOYVJSHNT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|