C29H35BrN6O3 — CID 171413975
tert-butyl (2R)-4-[7-bromo-3-cyano-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinolin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate (PubChem CID 171413975) has the molecular formula C29H35BrN6O3 and a molecular weight of 595.54 g/mol. Its IUPAC name is tert-butyl (2R)-4-[7-bromo-3-cyano-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinolin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[7-bromo-3-cyano-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinolin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171413975 |
| Molecular Formula | C29H35BrN6O3 |
| Molecular Weight | 595.54 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | tert-butyl (2R)-4-[7-bromo-3-cyano-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinolin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate |
| SMILES | [C-]#[N+]C[C@H]1CN(c2c(C#N)c(OCC34CCCN3CCC4)nc3cc(Br)ccc23)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H35BrN6O3/c1-28(2,3)39-27(37)36-14-13-34(18-21(36)17-32-4)25-22-8-7-20(30)15-24(22)33-26(23(25)16-31)38-19-29-9-5-11-35(29)12-6-10-29/h7-8,15,21H,5-6,9-14,17-19H2,1-3H3/t21-/m0/s1 |
| InChIKey | XOARGZOEVPMWAS-NRFANRHFSA-N |
| XLogP | 5.22 |
| TPSA | 86.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|