C14H18N2O3 — CID 171414093
N-(6-methyl-2,5-dioxoheptyl)pyridine-3-carboxamide (PubChem CID 171414093) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(6-methyl-2,5-dioxoheptyl)pyridine-3-carboxamide.
| Compound Name | N-(6-methyl-2,5-dioxoheptyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171414093 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(6-methyl-2,5-dioxoheptyl)pyridine-3-carboxamide |
| SMILES | CC(C)C(=O)CCC(=O)CNC(=O)c1cccnc1 |
| InChI | InChI=1S/C14H18N2O3/c1-10(2)13(18)6-5-12(17)9-16-14(19)11-4-3-7-15-8-11/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,16,19) |
| InChIKey | UIEUDJLDSBLYQH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |