C51H29N3O2 — CID 171414622
2-dibenzofuran-3-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-triphenylen-2-yldibenzofuran-4-yl)-1,3,5-triazine (PubChem CID 171414622) has the molecular formula C51H29N3O2 and a molecular weight of 720.84 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-triphenylen-2-yldibenzofuran-4-yl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-triphenylen-2-yldibenzofuran-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171414622 |
| Molecular Formula | C51H29N3O2 |
| Molecular Weight | 720.84 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(9-triphenylen-2-yldibenzofuran-4-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3cccc4c3oc3cccc(-c5ccc6c7ccccc7c7ccccc7c6c5)c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H29N3O2/c1-2-12-30(13-3-1)49-52-50(32-25-27-40-39-18-8-9-22-44(39)55-46(40)29-32)54-51(53-49)42-21-10-20-41-47-33(19-11-23-45(47)56-48(41)42)31-24-26-38-36-16-5-4-14-34(36)35-15-6-7-17-37(35)43(38)28-31/h1-29H/i1D,2D,3D,12D,13D |
| InChIKey | PTBBWGQENUQWAI-AYAICNHJSA-N |
| XLogP | 13.80 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.84 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|