C38H26O — CID 171420576
9-[10-(2-cyclohexa-2,4-dien-1-yl-3,4,5,6-tetradeuteriophenyl)anthracen-9-yl]-1,2,3,4,7,8-hexadeuteriodibenzofuran (PubChem CID 171420576) has the molecular formula C38H26O and a molecular weight of 508.69 g/mol. Its IUPAC name is 9-[10-(2-cyclohexa-2,4-dien-1-yl-3,4,5,6-tetradeuteriophenyl)anthracen-9-yl]-1,2,3,4,7,8-hexadeuteriodibenzofuran.
| Compound Name | 9-[10-(2-cyclohexa-2,4-dien-1-yl-3,4,5,6-tetradeuteriophenyl)anthracen-9-yl]-1,2,3,4,7,8-hexadeuteriodibenzofuran |
|---|---|
| PubChem CID | 171420576 |
| Molecular Formula | C38H26O |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 9-[10-(2-cyclohexa-2,4-dien-1-yl-3,4,5,6-tetradeuteriophenyl)anthracen-9-yl]-1,2,3,4,7,8-hexadeuteriodibenzofuran |
| SMILES | [2H]c1cc2oc3c([2H])c([2H])c([2H])c([2H])c3c2c(-c2c3ccccc3c(-c3c([2H])c([2H])c([2H])c([2H])c3C3C=CC=CC3)c3ccccc23)c1[2H] |
| InChI | InChI=1S/C38H26O/c1-2-13-25(14-3-1)26-15-4-5-16-27(26)36-28-17-6-8-19-30(28)37(31-20-9-7-18-29(31)36)33-22-12-24-35-38(33)32-21-10-11-23-34(32)39-35/h1-13,15-25H,14H2/i4D,5D,10D,11D,12D,15D,16D,21D,22D,23D |
| InChIKey | CFBWOLLUAUFTRL-OJUHYNGRSA-N |
| XLogP | 10.83 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|