C45H26N6 — CID 171421501
9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-11-isocyanobenzo[a]fluorene-11-carbonitrile (PubChem CID 171421501) has the molecular formula C45H26N6 and a molecular weight of 650.75 g/mol. Its IUPAC name is 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-11-isocyanobenzo[a]fluorene-11-carbonitrile.
| Compound Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-11-isocyanobenzo[a]fluorene-11-carbonitrile |
|---|---|
| PubChem CID | 171421501 |
| Molecular Formula | C45H26N6 |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-11-isocyanobenzo[a]fluorene-11-carbonitrile |
| SMILES | [C-]#[N+]C1(C#N)c2cc(-c3cc(-c4cccnc4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc2-c2ccc3ccccc3c21 |
| InChI | InChI=1S/C45H26N6/c1-47-45(28-46)40-26-32(19-20-38(40)39-21-18-29-11-8-9-17-37(29)41(39)45)34-23-35(33-16-10-22-48-27-33)25-36(24-34)44-50-42(30-12-4-2-5-13-30)49-43(51-44)31-14-6-3-7-15-31/h2-27H |
| InChIKey | JUMWFWSTTUHSIM-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|