C19H23FN7O7P — CID 171422396
[(2R,4S,5R)-4-fluoro-5-[6-(methylamino)purin-9-yl]-3-(4-oxopentanoyloxy)oxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid (PubChem CID 171422396) has the molecular formula C19H23FN7O7P and a molecular weight of 511.41 g/mol. Its IUPAC name is [(2R,4S,5R)-4-fluoro-5-[6-(methylamino)purin-9-yl]-3-(4-oxopentanoyloxy)oxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid.
| Compound Name | [(2R,4S,5R)-4-fluoro-5-[6-(methylamino)purin-9-yl]-3-(4-oxopentanoyloxy)oxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 171422396 |
| Molecular Formula | C19H23FN7O7P |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [(2R,4S,5R)-4-fluoro-5-[6-(methylamino)purin-9-yl]-3-(4-oxopentanoyloxy)oxolan-2-yl]methoxy-imidazol-1-ylphosphinic acid |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)n2ccnc2)C(OC(=O)CCC(C)=O)[C@@H]1F |
| InChI | InChI=1S/C19H23FN7O7P/c1-11(28)3-4-13(29)34-16-12(7-32-35(30,31)26-6-5-22-9-26)33-19(14(16)20)27-10-25-15-17(21-2)23-8-24-18(15)27/h5-6,8-10,12,14,16,19H,3-4,7H2,1-2H3,(H,30,31)(H,21,23,24)/t12-,14+,16?,19-/m1/s1 |
| InChIKey | MBZDBPXVKSPCGB-DDAVFFBNSA-N |
| XLogP | 1.25 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|