C34H22N3OPtS- — CID 171424869
2-[1-phenyl-4-[3-(3,5,6-trideuterio-4-thiophen-2-yl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 171424869) has the molecular formula C34H22N3OPtS- and a molecular weight of 718.73 g/mol. Its IUPAC name is 2-[1-phenyl-4-[3-(3,5,6-trideuterio-4-thiophen-2-yl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-phenyl-4-[3-(3,5,6-trideuterio-4-thiophen-2-yl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 171424869 |
| Molecular Formula | C34H22N3OPtS- |
| Molecular Weight | 718.73 g/mol |
| Exact Mass | 718.13 |
| IUPAC Name | 2-[1-phenyl-4-[3-(3,5,6-trideuterio-4-thiophen-2-yl-2-pyridinyl)benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | [2H]c1nc(-c2[c-]c(-c3cccc4c3nc(-c3ccccc3O)n4-c3ccccc3)ccc2)c([2H])c(-c2cccs2)c1[2H].[Pt] |
| InChI | InChI=1S/C34H22N3OS.Pt/c38-31-16-5-4-13-28(31)34-36-33-27(14-7-15-30(33)37(34)26-11-2-1-3-12-26)23-9-6-10-24(21-23)29-22-25(18-19-35-29)32-17-8-20-39-32;/h1-20,22,38H;/q-1;/i18D,19D,22D; |
| InChIKey | IMEBCQBGEGHSKM-OLDMNNGTSA-N |
| XLogP | 8.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.73 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|