C34H23N3OS — CID 171425112
2-[4-[3-(5-deuterio-4-thiophen-2-yl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol (PubChem CID 171425112) has the molecular formula C34H23N3OS and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[4-[3-(5-deuterio-4-thiophen-2-yl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol.
| Compound Name | 2-[4-[3-(5-deuterio-4-thiophen-2-yl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 171425112 |
| Molecular Formula | C34H23N3OS |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[4-[3-(5-deuterio-4-thiophen-2-yl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol |
| SMILES | [2H]c1cnc(-c2cccc(-c3cccc4c3nc(-c3ccccc3O)n4-c3ccccc3)c2)cc1-c1cccs1 |
| InChI | InChI=1S/C34H23N3OS/c38-31-16-5-4-13-28(31)34-36-33-27(14-7-15-30(33)37(34)26-11-2-1-3-12-26)23-9-6-10-24(21-23)29-22-25(18-19-35-29)32-17-8-20-39-32/h1-22,38H/i18D |
| InChIKey | LZHUEGQZSIUOND-VAAKKRCDSA-N |
| XLogP | 8.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |