About 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine
10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine (PubChem CID 171429197) has the molecular formula C14H14N3O2+
and a molecular weight of 256.28 g/mol. Its IUPAC name is 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine.
Molecular Properties
| Compound Name | 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine |
| PubChem CID | 171429197 |
| Molecular Formula | C14H14N3O2+ |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine |
| SMILES | Cc1cc2c(cc1C)[n+](=O)c1ccc(N)cc1n2O |
| InChI | InChI=1S/C14H14N3O2/c1-8-5-12-13(6-9(8)2)17(19)14-7-10(15)3-4-11(14)16(12)18/h3-7,19H,15H2,1-2H3/q+1 |
| InChIKey | FOJRBBDMOAFMFC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine?
The IUPAC name of 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine (CID 171429197) is 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine.
What is the SMILES notation for 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine?
The canonical SMILES for 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine is Cc1cc2c(cc1C)[n+](=O)c1ccc(N)cc1n2O.
What is the InChIKey of 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine?
The InChIKey is FOJRBBDMOAFMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N3O2/c1-8-5-12-13(6-9(8)2)17(19)14-7-10(15)3-4-11(14)16(12)18/h3-7,19H,15H2,1-2H3/q+1.
What are the key properties of 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine?
10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine has a molecular weight of 256.28 g/mol, XLogP of 2.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxy-7,8-dimethyl-5-oxophenazin-5-ium-2-amine is sourced from PubChem (CID 171429197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).