C24H25ClN4O6 — CID 171429787
ethyl N-[2-[bis[(4-methoxyphenyl)methyl]amino]-6-chloro-3-nitro-4-pyridinyl]carbamate (PubChem CID 171429787) has the molecular formula C24H25ClN4O6 and a molecular weight of 500.94 g/mol. Its IUPAC name is ethyl N-[2-[bis[(4-methoxyphenyl)methyl]amino]-6-chloro-3-nitro-4-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-[bis[(4-methoxyphenyl)methyl]amino]-6-chloro-3-nitro-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 171429787 |
| Molecular Formula | C24H25ClN4O6 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | ethyl N-[2-[bis[(4-methoxyphenyl)methyl]amino]-6-chloro-3-nitro-4-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(Cl)nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25ClN4O6/c1-4-35-24(30)26-20-13-21(25)27-23(22(20)29(31)32)28(14-16-5-9-18(33-2)10-6-16)15-17-7-11-19(34-3)12-8-17/h5-13H,4,14-15H2,1-3H3,(H,26,27,30) |
| InChIKey | KLMYMEZUSKZBPW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|