C32H42N4O5 — CID 86642558
2-N,2-N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-N-(oxan-4-ylmethyl)-6-pentylpyridine-2,4-diamine (PubChem CID 86642558) has the molecular formula C32H42N4O5 and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-N,2-N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-N-(oxan-4-ylmethyl)-6-pentylpyridine-2,4-diamine.
| Compound Name | 2-N,2-N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-N-(oxan-4-ylmethyl)-6-pentylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 86642558 |
| Molecular Formula | C32H42N4O5 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 2-N,2-N-bis[(4-methoxyphenyl)methyl]-3-nitro-4-N-(oxan-4-ylmethyl)-6-pentylpyridine-2,4-diamine |
| SMILES | CCCCCc1cc(NCC2CCOCC2)c([N+](=O)[O-])c(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C32H42N4O5/c1-4-5-6-7-27-20-30(33-21-24-16-18-41-19-17-24)31(36(37)38)32(34-27)35(22-25-8-12-28(39-2)13-9-25)23-26-10-14-29(40-3)15-11-26/h8-15,20,24H,4-7,16-19,21-23H2,1-3H3,(H,33,34) |
| InChIKey | QTFORRUGWVDFHP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|