C16H24N2O2S — CID 17143030
N-(butylcarbamothioyl)-2-(2-methylpropoxy)benzamide (PubChem CID 17143030) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(butylcarbamothioyl)-2-(2-methylpropoxy)benzamide.
| Compound Name | N-(butylcarbamothioyl)-2-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17143030 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-(butylcarbamothioyl)-2-(2-methylpropoxy)benzamide |
| SMILES | CCCCNC(=S)NC(=O)c1ccccc1OCC(C)C |
| InChI | InChI=1S/C16H24N2O2S/c1-4-5-10-17-16(21)18-15(19)13-8-6-7-9-14(13)20-11-12(2)3/h6-9,12H,4-5,10-11H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | SROJHJGVZROUDK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|