C86H158N4O20S5 — CID 171432365
2-[3-[2-[bis[2-[bis[3-[2-(2-octylsulfanylpropanoyloxy)ethoxy]-3-oxopropyl]amino]ethyl]amino]ethylamino]propanoyloxy]ethyl 2-octylsulfanylpropanoate (PubChem CID 171432365) has the molecular formula C86H158N4O20S5 and a molecular weight of 1728.55 g/mol. Its IUPAC name is 2-[3-[2-[bis[2-[bis[3-[2-(2-octylsulfanylpropanoyloxy)ethoxy]-3-oxopropyl]amino]ethyl]amino]ethylamino]propanoyloxy]ethyl 2-octylsulfanylpropanoate.
| Compound Name | 2-[3-[2-[bis[2-[bis[3-[2-(2-octylsulfanylpropanoyloxy)ethoxy]-3-oxopropyl]amino]ethyl]amino]ethylamino]propanoyloxy]ethyl 2-octylsulfanylpropanoate |
|---|---|
| PubChem CID | 171432365 |
| Molecular Formula | C86H158N4O20S5 |
| Molecular Weight | 1728.55 g/mol |
| Exact Mass | 1727.01 |
| IUPAC Name | 2-[3-[2-[bis[2-[bis[3-[2-(2-octylsulfanylpropanoyloxy)ethoxy]-3-oxopropyl]amino]ethyl]amino]ethylamino]propanoyloxy]ethyl 2-octylsulfanylpropanoate |
| SMILES | CCCCCCCCSC(C)C(=O)OCCOC(=O)CCNCCN(CCN(CCC(=O)OCCOC(=O)C(C)SCCCCCCCC)CCC(=O)OCCOC(=O)C(C)SCCCCCCCC)CCN(CCC(=O)OCCOC(=O)C(C)SCCCCCCCC)CCC(=O)OCCOC(=O)C(C)SCCCCCCCC |
| InChI | InChI=1S/C86H158N4O20S5/c1-11-16-21-26-31-36-67-111-72(6)82(96)106-62-57-101-77(91)41-46-87-47-52-90(55-53-88(48-42-78(92)102-58-63-107-83(97)73(7)112-68-37-32-27-22-17-12-2)49-43-79(93)103-59-64-108-84(98)74(8)113-69-38-33-28-23-18-13-3)56-54-89(50-44-80(94)104-60-65-109-85(99)75(9)114-70-39-34-29-24-19-14-4)51-45-81(95)105-61-66-110-86(100)76(10)115-71-40-35-30-25-20-15-5/h72-76,87H,11-71H2,1-10H3 |
| InChIKey | UJKMDJYBAISTSM-UHFFFAOYSA-N |
| XLogP | 16.28 |
| TPSA | 284.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 29 |
| Rotatable Bonds | 84 |
| Heavy Atoms | 115 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1728.55 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 29 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|