C48H91N4O12+ — CID 91049974
2-[bis(3-butoxy-3-oxopropyl)amino]ethyl-[2-[2-[bis(3-butoxy-3-oxopropyl)amino]ethylamino]ethyl]-bis(3-butoxy-3-oxopropyl)azanium (PubChem CID 91049974) has the molecular formula C48H91N4O12+ and a molecular weight of 916.27 g/mol. Its IUPAC name is 2-[bis(3-butoxy-3-oxopropyl)amino]ethyl-[2-[2-[bis(3-butoxy-3-oxopropyl)amino]ethylamino]ethyl]-bis(3-butoxy-3-oxopropyl)azanium.
| Compound Name | 2-[bis(3-butoxy-3-oxopropyl)amino]ethyl-[2-[2-[bis(3-butoxy-3-oxopropyl)amino]ethylamino]ethyl]-bis(3-butoxy-3-oxopropyl)azanium |
|---|---|
| PubChem CID | 91049974 |
| Molecular Formula | C48H91N4O12+ |
| Molecular Weight | 916.27 g/mol |
| Exact Mass | 915.66 |
| IUPAC Name | 2-[bis(3-butoxy-3-oxopropyl)amino]ethyl-[2-[2-[bis(3-butoxy-3-oxopropyl)amino]ethylamino]ethyl]-bis(3-butoxy-3-oxopropyl)azanium |
| SMILES | CCCCOC(=O)CCN(CCNCC[N+](CCC(=O)OCCCC)(CCC(=O)OCCCC)CCN(CCC(=O)OCCCC)CCC(=O)OCCCC)CCC(=O)OCCCC |
| InChI | InChI=1S/C48H91N4O12/c1-7-13-37-59-43(53)19-27-50(28-20-44(54)60-38-14-8-2)31-25-49-26-35-52(33-23-47(57)63-41-17-11-5,34-24-48(58)64-42-18-12-6)36-32-51(29-21-45(55)61-39-15-9-3)30-22-46(56)62-40-16-10-4/h49H,7-42H2,1-6H3/q+1 |
| InChIKey | GOJFXRSYPAWTBV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 176.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.27 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|