C42H27NOS — CID 171434645
1,2,3,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzofuran-4-amine (PubChem CID 171434645) has the molecular formula C42H27NOS and a molecular weight of 600.79 g/mol. Its IUPAC name is 1,2,3,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzofuran-4-amine.
| Compound Name | 1,2,3,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 171434645 |
| Molecular Formula | C42H27NOS |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 1,2,3,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzofuran-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)c5c4sc4ccccc45)c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C42H27NOS/c1-3-12-28(13-4-1)29-22-24-31(25-23-29)43(36-19-11-18-34-33-16-7-9-20-38(33)44-41(34)36)37-27-26-32(30-14-5-2-6-15-30)40-35-17-8-10-21-39(35)45-42(37)40/h1-27H/i7D,9D,11D,16D,18D,19D,20D |
| InChIKey | KRWOWLUHGAUCEA-RUKYOCSDSA-N |
| XLogP | 12.76 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |