C42H27NS2 — CID 171435148
1,2,4,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzothiophen-3-amine (PubChem CID 171435148) has the molecular formula C42H27NS2 and a molecular weight of 616.86 g/mol. Its IUPAC name is 1,2,4,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzothiophen-3-amine.
| Compound Name | 1,2,4,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzothiophen-3-amine |
|---|---|
| PubChem CID | 171435148 |
| Molecular Formula | C42H27NS2 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 1,2,4,6,7,8,9-heptadeuterio-N-(1-phenyldibenzothiophen-4-yl)-N-(4-phenylphenyl)dibenzothiophen-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)c5c4sc4ccccc45)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C42H27NS2/c1-3-11-28(12-4-1)29-19-21-31(22-20-29)43(32-23-24-35-34-15-7-9-17-38(34)44-40(35)27-32)37-26-25-33(30-13-5-2-6-14-30)41-36-16-8-10-18-39(36)45-42(37)41/h1-27H/i7D,9D,15D,17D,23D,24D,27D |
| InChIKey | HXGGGMJUEUILSM-BIMADWDRSA-N |
| XLogP | 13.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |