C48H31NS2 — CID 171435094
N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzothiophen-4-amine (PubChem CID 171435094) has the molecular formula C48H31NS2 and a molecular weight of 692.96 g/mol. Its IUPAC name is N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzothiophen-4-amine.
| Compound Name | N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzothiophen-4-amine |
|---|---|
| PubChem CID | 171435094 |
| Molecular Formula | C48H31NS2 |
| Molecular Weight | 692.96 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzothiophen-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c([2H])c(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5c(-c6ccccc6)ccc6c5sc5ccccc56)cc4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C48H31NS2/c1-3-11-32(12-4-1)33-19-24-37(25-20-33)49(38-26-21-34(22-27-38)36-23-30-46-43(31-36)41-16-8-9-17-44(41)50-46)47-39(35-13-5-2-6-14-35)28-29-42-40-15-7-10-18-45(40)51-48(42)47/h1-31H/i8D,9D,16D,17D,23D,30D,31D |
| InChIKey | CIDLFRPUZLFMPG-ISYYFKFTSA-N |
| XLogP | 14.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.96 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |