C48H31NOS — CID 171435612
N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzofuran-4-amine (PubChem CID 171435612) has the molecular formula C48H31NOS and a molecular weight of 676.89 g/mol. Its IUPAC name is N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzofuran-4-amine.
| Compound Name | N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 171435612 |
| Molecular Formula | C48H31NOS |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | N-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)phenyl]-3-phenyl-N-(4-phenylphenyl)dibenzofuran-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c([2H])c(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5c(-c6ccccc6)ccc6c5oc5ccccc56)cc4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C48H31NOS/c1-3-11-32(12-4-1)33-19-24-37(25-20-33)49(38-26-21-34(22-27-38)36-23-30-46-43(31-36)41-16-8-10-18-45(41)51-46)47-39(35-13-5-2-6-14-35)28-29-42-40-15-7-9-17-44(40)50-48(42)47/h1-31H/i8D,10D,16D,18D,23D,30D,31D |
| InChIKey | HPXNWFRZPGRWQO-HSSKDXBVSA-N |
| XLogP | 14.42 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |