C21H17F2N7O3 — CID 171437404
[2-(2,4-difluoroanilino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyrimidin-5-yl] formate (PubChem CID 171437404) has the molecular formula C21H17F2N7O3 and a molecular weight of 453.41 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyrimidin-5-yl] formate.
| Compound Name | [2-(2,4-difluoroanilino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyrimidin-5-yl] formate |
|---|---|
| PubChem CID | 171437404 |
| Molecular Formula | C21H17F2N7O3 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | [2-(2,4-difluoroanilino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyrimidin-5-yl] formate |
| SMILES | COc1c(Nc2nc(Nc3ccc(F)cc3F)ncc2OC=O)cccc1-c1ncn(C)n1 |
| InChI | InChI=1S/C21H17F2N7O3/c1-30-10-25-19(29-30)13-4-3-5-16(18(13)32-2)26-20-17(33-11-31)9-24-21(28-20)27-15-7-6-12(22)8-14(15)23/h3-11H,1-2H3,(H2,24,26,27,28) |
| InChIKey | BJHSMUITTRKMPO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|