C49H38IrN3O — CID 171438333
iridium(3+);2-phenylpyridine;2-phenyl-4-[2-[2-[2-[2-(3-pyridin-2-ylbenzene-4-id-1-yl)ethyl]phenoxy]phenyl]ethyl]pyridine (PubChem CID 171438333) has the molecular formula C49H38IrN3O and a molecular weight of 877.08 g/mol. Its IUPAC name is iridium(3+);2-phenylpyridine;2-phenyl-4-[2-[2-[2-[2-(3-pyridin-2-ylbenzene-4-id-1-yl)ethyl]phenoxy]phenyl]ethyl]pyridine.
| Compound Name | iridium(3+);2-phenylpyridine;2-phenyl-4-[2-[2-[2-[2-(3-pyridin-2-ylbenzene-4-id-1-yl)ethyl]phenoxy]phenyl]ethyl]pyridine |
|---|---|
| PubChem CID | 171438333 |
| Molecular Formula | C49H38IrN3O |
| Molecular Weight | 877.08 g/mol |
| Exact Mass | 877.26 |
| IUPAC Name | iridium(3+);2-phenylpyridine;2-phenyl-4-[2-[2-[2-[2-(3-pyridin-2-ylbenzene-4-id-1-yl)ethyl]phenoxy]phenyl]ethyl]pyridine |
| SMILES | [Ir+3].[c-]1ccccc1-c1cc(CCc2ccccc2Oc2ccccc2CCc2cc[c-]c(-c3ccccn3)c2)ccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C38H30N2O.C11H8N.Ir/c1-2-12-31(13-3-1)36-28-30(24-26-40-36)21-23-33-15-5-7-19-38(33)41-37-18-6-4-14-32(37)22-20-29-11-10-16-34(27-29)35-17-8-9-25-39-35;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-12,14-15,17-19,24-28H,20-23H2;1-6,8-9H;/q-2;-1;+3 |
| InChIKey | USUSPCXJXOVNQE-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.08 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|