C22H30ClN3O3 — CID 171441034
N-[1-(1-acetylazepane-4-carbonyl)piperidin-4-yl]-2-chloro-N-phenylacetamide (PubChem CID 171441034) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is N-[1-(1-acetylazepane-4-carbonyl)piperidin-4-yl]-2-chloro-N-phenylacetamide.
| Compound Name | N-[1-(1-acetylazepane-4-carbonyl)piperidin-4-yl]-2-chloro-N-phenylacetamide |
|---|---|
| PubChem CID | 171441034 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[1-(1-acetylazepane-4-carbonyl)piperidin-4-yl]-2-chloro-N-phenylacetamide |
| SMILES | CC(=O)N1CCCC(C(=O)N2CCC(N(C(=O)CCl)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H30ClN3O3/c1-17(27)24-12-5-6-18(9-13-24)22(29)25-14-10-20(11-15-25)26(21(28)16-23)19-7-3-2-4-8-19/h2-4,7-8,18,20H,5-6,9-16H2,1H3 |
| InChIKey | ZVCCDOPXEPNUDS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|