C8H13FN4O7S2 — CID 171441280
[(2S,5R)-2-[(Z)-N'-(fluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 171441280) has the molecular formula C8H13FN4O7S2 and a molecular weight of 360.35 g/mol. Its IUPAC name is [(2S,5R)-2-[(Z)-N'-(fluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[(Z)-N'-(fluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 171441280 |
| Molecular Formula | C8H13FN4O7S2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | [(2S,5R)-2-[(Z)-N'-(fluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\S(=O)(=O)CF)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C8H13FN4O7S2/c9-4-21(15,16)11-7(10)6-2-1-5-3-12(6)8(14)13(5)20-22(17,18)19/h5-6H,1-4H2,(H2,10,11)(H,17,18,19)/t5-,6+/m1/s1 |
| InChIKey | ZOOQOKGJKMZRHS-RITPCOANSA-N |
| XLogP | -1.40 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|