C20H16BrF2NS2 — CID 171441346
4-bromo-2,6-difluoro-N,N-bis(2-methylsulfanylphenyl)aniline (PubChem CID 171441346) has the molecular formula C20H16BrF2NS2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N,N-bis(2-methylsulfanylphenyl)aniline.
| Compound Name | 4-bromo-2,6-difluoro-N,N-bis(2-methylsulfanylphenyl)aniline |
|---|---|
| PubChem CID | 171441346 |
| Molecular Formula | C20H16BrF2NS2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 4-bromo-2,6-difluoro-N,N-bis(2-methylsulfanylphenyl)aniline |
| SMILES | CSc1ccccc1N(c1ccccc1SC)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C20H16BrF2NS2/c1-25-18-9-5-3-7-16(18)24(17-8-4-6-10-19(17)26-2)20-14(22)11-13(21)12-15(20)23/h3-12H,1-2H3 |
| InChIKey | SVKSXZSLGNJRPA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |