C51H46BN5 — CID 171448506
N,N-bis(4-tert-butylphenyl)-8,14-diphenyl-8,14,16,22-tetraza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),17,19,21-decaen-19-amine (PubChem CID 171448506) has the molecular formula C51H46BN5 and a molecular weight of 739.78 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-8,14-diphenyl-8,14,16,22-tetraza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),17,19,21-decaen-19-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-8,14-diphenyl-8,14,16,22-tetraza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),17,19,21-decaen-19-amine |
|---|---|
| PubChem CID | 171448506 |
| Molecular Formula | C51H46BN5 |
| Molecular Weight | 739.78 g/mol |
| Exact Mass | 739.38 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-8,14-diphenyl-8,14,16,22-tetraza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2,4,6,9(24),10,12,15(23),17,19,21-decaen-19-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccn3c4c(nc3c2)B2c3ccccc3N(c3ccccc3)c3cccc(c32)N4c2ccccc2)cc1 |
| InChI | InChI=1S/C51H46BN5/c1-50(2,3)35-24-28-39(29-25-35)55(40-30-26-36(27-31-40)51(4,5)6)41-32-33-54-46(34-41)53-48-49(54)57(38-18-11-8-12-19-38)45-23-15-22-44-47(45)52(48)42-20-13-14-21-43(42)56(44)37-16-9-7-10-17-37/h7-34H,1-6H3 |
| InChIKey | PCBHNNHZYHKUNN-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 27.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.78 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|