C48H46BNO3 — CID 171448875
25-tert-butyl-N,N-bis(4-tert-butylphenyl)-6,15,21-trioxa-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2,4,7,9,11,13,16,18,20(28),22(27),23,25-dodecaen-4-amine (PubChem CID 171448875) has the molecular formula C48H46BNO3 and a molecular weight of 695.71 g/mol. Its IUPAC name is 25-tert-butyl-N,N-bis(4-tert-butylphenyl)-6,15,21-trioxa-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2,4,7,9,11,13,16,18,20(28),22(27),23,25-dodecaen-4-amine.
| Compound Name | 25-tert-butyl-N,N-bis(4-tert-butylphenyl)-6,15,21-trioxa-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2,4,7,9,11,13,16,18,20(28),22(27),23,25-dodecaen-4-amine |
|---|---|
| PubChem CID | 171448875 |
| Molecular Formula | C48H46BNO3 |
| Molecular Weight | 695.71 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | 25-tert-butyl-N,N-bis(4-tert-butylphenyl)-6,15,21-trioxa-1-boraheptacyclo[14.11.1.02,14.05,13.07,12.020,28.022,27]octacosa-2,4,7,9,11,13,16,18,20(28),22(27),23,25-dodecaen-4-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc3c(c4c2oc2ccccc24)Oc2cccc4c2B3c2cc(C(C)(C)C)ccc2O4)cc1 |
| InChI | InChI=1S/C48H46BNO3/c1-46(2,3)29-17-22-32(23-18-29)50(33-24-19-30(20-25-33)47(4,5)6)37-28-36-44(42-34-13-10-11-14-38(34)52-45(37)42)53-41-16-12-15-40-43(41)49(36)35-27-31(48(7,8)9)21-26-39(35)51-40/h10-28H,1-9H3 |
| InChIKey | WTOIKJWDSXKBND-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.71 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|