C47H44BNO2 — CID 153498331
4,12-ditert-butyl-N-dibenzofuran-2-yl-14,14-dimethyl-N-phenyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-17-amine (PubChem CID 153498331) has the molecular formula C47H44BNO2 and a molecular weight of 665.69 g/mol. Its IUPAC name is 4,12-ditert-butyl-N-dibenzofuran-2-yl-14,14-dimethyl-N-phenyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-17-amine.
| Compound Name | 4,12-ditert-butyl-N-dibenzofuran-2-yl-14,14-dimethyl-N-phenyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-17-amine |
|---|---|
| PubChem CID | 153498331 |
| Molecular Formula | C47H44BNO2 |
| Molecular Weight | 665.69 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | 4,12-ditert-butyl-N-dibenzofuran-2-yl-14,14-dimethyl-N-phenyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-17-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3ccc(N(c4ccccc4)c4ccc5oc6ccccc6c5c4)cc3C(C)(C)c3c(C(C)(C)C)ccc(c31)O2 |
| InChI | InChI=1S/C47H44BNO2/c1-45(2,3)29-18-23-41-38(26-29)48-37-22-19-32(28-36(37)47(7,8)43-35(46(4,5)6)21-25-42(51-41)44(43)48)49(30-14-10-9-11-15-30)31-20-24-40-34(27-31)33-16-12-13-17-39(33)50-40/h9-28H,1-8H3 |
| InChIKey | AGKIOXGHUVONSO-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.69 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|