C47H46BNO — CID 153498142
4-(4,12-ditert-butyl-14,14-dimethyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-18-yl)-N,N-diphenylaniline (PubChem CID 153498142) has the molecular formula C47H46BNO and a molecular weight of 651.70 g/mol. Its IUPAC name is 4-(4,12-ditert-butyl-14,14-dimethyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-18-yl)-N,N-diphenylaniline.
| Compound Name | 4-(4,12-ditert-butyl-14,14-dimethyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-18-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 153498142 |
| Molecular Formula | C47H46BNO |
| Molecular Weight | 651.70 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | 4-(4,12-ditert-butyl-14,14-dimethyl-8-oxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-18-yl)-N,N-diphenylaniline |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3cc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc3C(C)(C)c3c(C(C)(C)C)ccc(c31)O2 |
| InChI | InChI=1S/C47H46BNO/c1-45(2,3)33-22-27-41-40(30-33)48-39-29-32(21-25-37(39)47(7,8)43-38(46(4,5)6)26-28-42(50-41)44(43)48)31-19-23-36(24-20-31)49(34-15-11-9-12-16-34)35-17-13-10-14-18-35/h9-30H,1-8H3 |
| InChIKey | RZNUHXYCPRQILD-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.70 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|