C35H45FN2O3S — CID 171450568
(3R)-8-(4-fluorophenyl)-2-methyl-7-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-(2-methylpropyl)-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide (PubChem CID 171450568) has the molecular formula C35H45FN2O3S and a molecular weight of 592.82 g/mol. Its IUPAC name is (3R)-8-(4-fluorophenyl)-2-methyl-7-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-(2-methylpropyl)-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide.
| Compound Name | (3R)-8-(4-fluorophenyl)-2-methyl-7-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-(2-methylpropyl)-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 171450568 |
| Molecular Formula | C35H45FN2O3S |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | (3R)-8-(4-fluorophenyl)-2-methyl-7-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3-(2-methylpropyl)-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepine 1,1-dioxide |
| SMILES | CC(C)C[C@@H]1CN(c2ccccc2)c2cc(O[C@@H]3C[C@H](C)CC[C@H]3C(C)C)c(-c3ccc(F)cc3)cc2S(=O)(=O)N1C |
| InChI | InChI=1S/C35H45FN2O3S/c1-23(2)18-29-22-38(28-10-8-7-9-11-28)32-21-34(41-33-19-25(5)12-17-30(33)24(3)4)31(26-13-15-27(36)16-14-26)20-35(32)42(39,40)37(29)6/h7-11,13-16,20-21,23-25,29-30,33H,12,17-19,22H2,1-6H3/t25-,29-,30+,33-/m1/s1 |
| InChIKey | BILOXKTZPOLKEC-RZEPRLFYSA-N |
| XLogP | 8.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |