C53H37N — CID 171451126
N-(3-naphthalen-1-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-4-amine (PubChem CID 171451126) has the molecular formula C53H37N and a molecular weight of 696.94 g/mol. Its IUPAC name is N-(3-naphthalen-1-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-4-amine.
| Compound Name | N-(3-naphthalen-1-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-4-amine |
|---|---|
| PubChem CID | 171451126 |
| Molecular Formula | C53H37N |
| Molecular Weight | 696.94 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | N-(3-naphthalen-1-ylphenyl)-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluoren-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3cccc(-c4cccc5ccccc45)c3)c3cccc4c3-c3ccccc3C4(c3ccccc3)c3ccccc3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C53H37N/c1-4-17-38(18-5-1)39-33-35-44(36-34-39)54(45-26-14-21-41(37-45)47-29-15-20-40-19-10-11-27-46(40)47)51-32-16-31-50-52(51)48-28-12-13-30-49(48)53(50,42-22-6-2-7-23-42)43-24-8-3-9-25-43/h1-37H/i1D,4D,5D,17D,18D,33D,34D,35D,36D |
| InChIKey | YJTIKURESKVJBK-RWNFGQDASA-N |
| XLogP | 14.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.94 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |