C59H41N — CID 171452058
9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]fluoren-4-amine (PubChem CID 171452058) has the molecular formula C59H41N and a molecular weight of 772.03 g/mol. Its IUPAC name is 9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]fluoren-4-amine.
| Compound Name | 9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]fluoren-4-amine |
|---|---|
| PubChem CID | 171452058 |
| Molecular Formula | C59H41N |
| Molecular Weight | 772.03 g/mol |
| Exact Mass | 771.37 |
| IUPAC Name | 9,9-diphenyl-N-(2,3,4,6-tetradeuterio-5-naphthalen-1-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]fluoren-4-amine |
| SMILES | [2H]c1c([2H])c(-c2cccc3ccccc23)c([2H])c(N(c2cccc3c2-c2ccccc2C3(c2ccccc2)c2ccccc2)c2c([2H])c([2H])c(-c3cccc(-c4ccccc4)c3)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C59H41N/c1-4-18-42(19-5-1)45-22-14-23-46(40-45)43-36-38-50(39-37-43)60(51-29-15-24-47(41-51)53-32-16-21-44-20-10-11-30-52(44)53)57-35-17-34-56-58(57)54-31-12-13-33-55(54)59(56,48-25-6-2-7-26-48)49-27-8-3-9-28-49/h1-41H/i15D,24D,29D,36D,37D,38D,39D,41D |
| InChIKey | YRAFLMMWWBPJNM-IMYASGGKSA-N |
| XLogP | 15.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.03 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |