C50H35N — CID 171451609
2,3,4,5,6,7,8-heptadeuterio-N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]naphthalen-1-amine (PubChem CID 171451609) has the molecular formula C50H35N and a molecular weight of 660.90 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 171451609 |
| Molecular Formula | C50H35N |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N-[4-(3-naphthalen-1-ylphenyl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(3-phenylphenyl)phenyl]naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc(-c4cccc5ccccc45)c3)cc2)c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c([2H])c1-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C50H35N/c1-2-12-36(13-3-1)41-18-8-19-42(34-41)37-26-30-45(31-27-37)51(50-25-11-17-40-15-5-7-23-49(40)50)46-32-28-38(29-33-46)43-20-9-21-44(35-43)48-24-10-16-39-14-4-6-22-47(39)48/h1-35H/i5D,7D,11D,15D,17D,23D,25D,26D,27D,30D,31D |
| InChIKey | VIUBTVOEFNZOOP-SDZALLRGSA-N |
| XLogP | 14.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |