C57H41NO — CID 171451744
2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)aniline (PubChem CID 171451744) has the molecular formula C57H41NO and a molecular weight of 764.01 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)aniline |
|---|---|
| PubChem CID | 171451744 |
| Molecular Formula | C57H41NO |
| Molecular Weight | 764.01 g/mol |
| Exact Mass | 763.37 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-[4-(9,9-dimethylfluoren-1-yl)phenyl]-4-(4-phenylphenyl)-N-(2,3,5,6-tetradeuterio-4-dibenzofuran-1-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4c3C(C)(C)c3ccccc3-4)cc2)c2c([2H])c([2H])c(-c3cccc4oc5ccccc5c34)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C57H41NO/c1-57(2)52-19-8-6-14-49(52)50-18-10-17-48(56(50)57)43-30-36-46(37-31-43)58(44-32-26-41(27-33-44)40-24-22-39(23-25-40)38-12-4-3-5-13-38)45-34-28-42(29-35-45)47-16-11-21-54-55(47)51-15-7-9-20-53(51)59-54/h3-37H,1-2H3/i26D,27D,28D,29D,32D,33D,34D,35D |
| InChIKey | FFUKKDGYOGLTRD-FAEFDFKZSA-N |
| XLogP | 16.03 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.01 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |