C53H39N — CID 171452807
N-(3,5-diphenylphenyl)-9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)fluoren-2-amine (PubChem CID 171452807) has the molecular formula C53H39N and a molecular weight of 693.93 g/mol. Its IUPAC name is N-(3,5-diphenylphenyl)-9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)fluoren-2-amine.
| Compound Name | N-(3,5-diphenylphenyl)-9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171452807 |
| Molecular Formula | C53H39N |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | N-(3,5-diphenylphenyl)-9,9-dimethyl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c([2H])c([2H])c1-c1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C53H39N/c1-53(2)51-20-12-11-19-48(51)49-30-29-45(35-52(49)53)54(46-32-42(36-13-5-3-6-14-36)31-43(33-46)37-15-7-4-8-16-37)44-27-25-38(26-28-44)41-24-23-40-22-21-39-17-9-10-18-47(39)50(40)34-41/h3-35H,1-2H3/i25D,26D,27D,28D |
| InChIKey | BYPKZKTUFBMJPI-VJERBKOKSA-N |
| XLogP | 14.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|