C46H30O — CID 171452821
11-[3-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3,4-dihydroanthracen-9-yl]phenyl]naphtho[2,1-b][1]benzofuran (PubChem CID 171452821) has the molecular formula C46H30O and a molecular weight of 605.79 g/mol. Its IUPAC name is 11-[3-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3,4-dihydroanthracen-9-yl]phenyl]naphtho[2,1-b][1]benzofuran.
| Compound Name | 11-[3-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3,4-dihydroanthracen-9-yl]phenyl]naphtho[2,1-b][1]benzofuran |
|---|---|
| PubChem CID | 171452821 |
| Molecular Formula | C46H30O |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 11-[3-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-3,4-dihydroanthracen-9-yl]phenyl]naphtho[2,1-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4c(c(-c5cccc(-c6cccc7oc8ccc9ccccc9c8c67)c5)c5ccccc35)C=CCC4)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C46H30O/c1-3-17-33-29(12-1)14-10-24-36(33)44-39-21-7-5-19-37(39)43(38-20-6-8-22-40(38)44)32-16-9-15-31(28-32)35-23-11-25-41-46(35)45-34-18-4-2-13-30(34)26-27-42(45)47-41/h1-7,9-21,23-28H,8,22H2/i1D,3D,10D,12D,14D,17D,24D |
| InChIKey | ZZSVOKLJCUHICO-IMXJJUTQSA-N |
| XLogP | 13.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |