C27H25ClN6O — CID 171454699
2-amino-4-[4-[(1S)-1-amino-6-ethynylspiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-2-methyl-6-oxopyrimidin-1-yl]-3-chlorobenzonitrile (PubChem CID 171454699) has the molecular formula C27H25ClN6O and a molecular weight of 484.99 g/mol. Its IUPAC name is 2-amino-4-[4-[(1S)-1-amino-6-ethynylspiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-2-methyl-6-oxopyrimidin-1-yl]-3-chlorobenzonitrile.
| Compound Name | 2-amino-4-[4-[(1S)-1-amino-6-ethynylspiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-2-methyl-6-oxopyrimidin-1-yl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 171454699 |
| Molecular Formula | C27H25ClN6O |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-amino-4-[4-[(1S)-1-amino-6-ethynylspiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-2-methyl-6-oxopyrimidin-1-yl]-3-chlorobenzonitrile |
| SMILES | C#Cc1ccc2c(c1)[C@@H](N)C1(CCN(c3cc(=O)n(-c4ccc(C#N)c(N)c4Cl)c(C)n3)CC1)C2 |
| InChI | InChI=1S/C27H25ClN6O/c1-3-17-4-5-18-14-27(26(31)20(18)12-17)8-10-33(11-9-27)22-13-23(35)34(16(2)32-22)21-7-6-19(15-29)25(30)24(21)28/h1,4-7,12-13,26H,8-11,14,30-31H2,2H3/t26-/m1/s1 |
| InChIKey | NHBQHPOOJROEAD-AREMUKBSSA-N |
| XLogP | 3.47 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|