C41H25N3O — CID 171461512
2,3,4,6-tetradeuterio-5-[2-(3-dibenzofuran-3-ylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrimidin-4-yl]benzonitrile (PubChem CID 171461512) has the molecular formula C41H25N3O and a molecular weight of 588.75 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-[2-(3-dibenzofuran-3-ylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2,3,4,6-tetradeuterio-5-[2-(3-dibenzofuran-3-ylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 171461512 |
| Molecular Formula | C41H25N3O |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-[2-(3-dibenzofuran-3-ylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]pyrimidin-4-yl]benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3cc(-c4c([2H])c([2H])c([2H])c(C#N)c4[2H])nc(-c4cccc(-c5ccc6c(c5)oc5ccccc56)c4)n3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C41H25N3O/c42-26-27-8-6-12-33(22-27)38-25-37(30-18-16-29(17-19-30)28-9-2-1-3-10-28)43-41(44-38)34-13-7-11-31(23-34)32-20-21-36-35-14-4-5-15-39(35)45-40(36)24-32/h1-25H/i1D,2D,3D,6D,8D,9D,10D,12D,16D,17D,18D,19D,22D |
| InChIKey | QKCUFNLIJQDNOL-RLMHYZJASA-N |
| XLogP | 10.58 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |