C6H13NO — CID 171466895
cis-(1S,2R)-2-propan-2-yloxycyclopropan-1-amine (PubChem CID 171466895) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is cis-(1S,2R)-2-propan-2-yloxycyclopropan-1-amine.
| Compound Name | cis-(1S,2R)-2-propan-2-yloxycyclopropan-1-amine |
|---|---|
| PubChem CID | 171466895 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | cis-(1S,2R)-2-propan-2-yloxycyclopropan-1-amine |
| SMILES | CC(C)O[C@@H]1C[C@@H]1N |
| InChI | InChI=1S/C6H13NO/c1-4(2)8-6-3-5(6)7/h4-6H,3,7H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | FYVAGZKHKJHOCD-NTSWFWBYSA-N |
| XLogP | 0.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |